C30H61N3O7 — CID 88853018
2-amino-2-(dimethylamino)pentanoic acid;(Z,12R)-12-hydroxyoctadec-9-enoic acid;2-(trimethylazaniumyl)acetate (PubChem CID 88853018) has the molecular formula C30H61N3O7 and a molecular weight of 575.83 g/mol. Its IUPAC name is 2-amino-2-(dimethylamino)pentanoic acid;(Z,12R)-12-hydroxyoctadec-9-enoic acid;2-(trimethylazaniumyl)acetate.
| Compound Name | 2-amino-2-(dimethylamino)pentanoic acid;(Z,12R)-12-hydroxyoctadec-9-enoic acid;2-(trimethylazaniumyl)acetate |
|---|---|
| PubChem CID | 88853018 |
| Molecular Formula | C30H61N3O7 |
| Molecular Weight | 575.83 g/mol |
| Exact Mass | 575.45 |
| IUPAC Name | 2-amino-2-(dimethylamino)pentanoic acid;(Z,12R)-12-hydroxyoctadec-9-enoic acid;2-(trimethylazaniumyl)acetate |
| SMILES | CCCC(N)(C(=O)O)N(C)C.CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)O.C[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C18H34O3.C7H16N2O2.C5H11NO2/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;1-4-5-7(8,6(10)11)9(2)3;1-6(2,3)4-5(7)8/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);4-5,8H2,1-3H3,(H,10,11);4H2,1-3H3/b12-9-;;/t17-;;/m1../s1 |
| InChIKey | IZPXKSKKETZRIX-GKKIQAINSA-N |
| XLogP | 3.61 |
| TPSA | 164.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.83 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|