C42H20F4N6 — CID 88853110
4-[5-[3-[8-(2,6-difluoro-4-isocyanophenyl)pyrido[3,2-b]indol-5-yl]phenyl]pyrido[3,2-b]indol-8-yl]-3,5-difluorobenzonitrile (PubChem CID 88853110) has the molecular formula C42H20F4N6 and a molecular weight of 684.66 g/mol. Its IUPAC name is 4-[5-[3-[8-(2,6-difluoro-4-isocyanophenyl)pyrido[3,2-b]indol-5-yl]phenyl]pyrido[3,2-b]indol-8-yl]-3,5-difluorobenzonitrile.
| Compound Name | 4-[5-[3-[8-(2,6-difluoro-4-isocyanophenyl)pyrido[3,2-b]indol-5-yl]phenyl]pyrido[3,2-b]indol-8-yl]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 88853110 |
| Molecular Formula | C42H20F4N6 |
| Molecular Weight | 684.66 g/mol |
| Exact Mass | 684.17 |
| IUPAC Name | 4-[5-[3-[8-(2,6-difluoro-4-isocyanophenyl)pyrido[3,2-b]indol-5-yl]phenyl]pyrido[3,2-b]indol-8-yl]-3,5-difluorobenzonitrile |
| SMILES | [C-]#[N+]c1cc(F)c(-c2ccc3c(c2)c2ncccc2n3-c2cccc(-n3c4ccc(-c5c(F)cc(C#N)cc5F)cc4c4ncccc43)c2)c(F)c1 |
| InChI | InChI=1S/C42H20F4N6/c1-48-26-19-33(45)40(34(46)20-26)25-10-12-36-30(18-25)42-38(8-4-14-50-42)52(36)28-6-2-5-27(21-28)51-35-11-9-24(17-29(35)41-37(51)7-3-13-49-41)39-31(43)15-23(22-47)16-32(39)44/h2-21H |
| InChIKey | SZJVGOJDPOHKJY-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 63.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.66 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|