C44H25F3N6 — CID 88853114
3-[5-[3-[8-[3-isocyano-5-(trifluoromethyl)phenyl]pyrido[3,2-b]indol-5-yl]phenyl]pyrido[3,2-b]indol-8-yl]-5-methylbenzonitrile (PubChem CID 88853114) has the molecular formula C44H25F3N6 and a molecular weight of 694.72 g/mol. Its IUPAC name is 3-[5-[3-[8-[3-isocyano-5-(trifluoromethyl)phenyl]pyrido[3,2-b]indol-5-yl]phenyl]pyrido[3,2-b]indol-8-yl]-5-methylbenzonitrile.
| Compound Name | 3-[5-[3-[8-[3-isocyano-5-(trifluoromethyl)phenyl]pyrido[3,2-b]indol-5-yl]phenyl]pyrido[3,2-b]indol-8-yl]-5-methylbenzonitrile |
|---|---|
| PubChem CID | 88853114 |
| Molecular Formula | C44H25F3N6 |
| Molecular Weight | 694.72 g/mol |
| Exact Mass | 694.21 |
| IUPAC Name | 3-[5-[3-[8-[3-isocyano-5-(trifluoromethyl)phenyl]pyrido[3,2-b]indol-5-yl]phenyl]pyrido[3,2-b]indol-8-yl]-5-methylbenzonitrile |
| SMILES | [C-]#[N+]c1cc(-c2ccc3c(c2)c2ncccc2n3-c2cccc(-n3c4ccc(-c5cc(C)cc(C#N)c5)cc4c4ncccc43)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C44H25F3N6/c1-26-16-27(25-48)18-30(17-26)28-10-12-38-36(21-28)42-40(8-4-14-50-42)52(38)34-6-3-7-35(24-34)53-39-13-11-29(22-37(39)43-41(53)9-5-15-51-43)31-19-32(44(45,46)47)23-33(20-31)49-2/h3-24H,1H3 |
| InChIKey | UGIWSDOGCNFOEU-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 63.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.72 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|