C11H10IN3OS — CID 88855816
2-amino-N-(2-iodo-6-methylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 88855816) has the molecular formula C11H10IN3OS and a molecular weight of 359.19 g/mol. Its IUPAC name is 2-amino-N-(2-iodo-6-methylphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-(2-iodo-6-methylphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 88855816 |
| Molecular Formula | C11H10IN3OS |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 2-amino-N-(2-iodo-6-methylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cccc(I)c1NC(=O)c1cnc(N)s1 |
| InChI | InChI=1S/C11H10IN3OS/c1-6-3-2-4-7(12)9(6)15-10(16)8-5-14-11(13)17-8/h2-5H,1H3,(H2,13,14)(H,15,16) |
| InChIKey | NQUWMLUDCUGQML-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|