C28H39N5O3S — CID 88857284
ethyl 3-[2-[(Z)-2-aminosulfanyl-3-(methylideneamino)but-2-enoyl]spiro[1,3-dihydroisoquinoline-4,4'-piperidine]-1'-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 88857284) has the molecular formula C28H39N5O3S and a molecular weight of 525.72 g/mol. Its IUPAC name is ethyl 3-[2-[(Z)-2-aminosulfanyl-3-(methylideneamino)but-2-enoyl]spiro[1,3-dihydroisoquinoline-4,4'-piperidine]-1'-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | ethyl 3-[2-[(Z)-2-aminosulfanyl-3-(methylideneamino)but-2-enoyl]spiro[1,3-dihydroisoquinoline-4,4'-piperidine]-1'-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 88857284 |
| Molecular Formula | C28H39N5O3S |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | ethyl 3-[2-[(Z)-2-aminosulfanyl-3-(methylideneamino)but-2-enoyl]spiro[1,3-dihydroisoquinoline-4,4'-piperidine]-1'-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | C=N/C(C)=C(\SN)C(=O)N1Cc2ccccc2C2(CCN(C3CC4CCC(C3)N4C(=O)OCC)CC2)C1 |
| InChI | InChI=1S/C28H39N5O3S/c1-4-36-27(35)33-21-9-10-22(33)16-23(15-21)31-13-11-28(12-14-31)18-32(17-20-7-5-6-8-24(20)28)26(34)25(37-29)19(2)30-3/h5-8,21-23H,3-4,9-18,29H2,1-2H3/b25-19- |
| InChIKey | KMJXCFPPBFVPCC-PLRJNAJWSA-N |
| XLogP | 4.05 |
| TPSA | 91.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|