C30H26N4O2 — CID 88858053
6-[(1S)-1-(4-isocyanophenyl)-1-(3-methylimidazol-4-yl)ethyl]-4-(3-methoxyphenyl)-1-methylquinolin-2-one (PubChem CID 88858053) has the molecular formula C30H26N4O2 and a molecular weight of 474.56 g/mol. Its IUPAC name is 6-[(1S)-1-(4-isocyanophenyl)-1-(3-methylimidazol-4-yl)ethyl]-4-(3-methoxyphenyl)-1-methylquinolin-2-one.
| Compound Name | 6-[(1S)-1-(4-isocyanophenyl)-1-(3-methylimidazol-4-yl)ethyl]-4-(3-methoxyphenyl)-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 88858053 |
| Molecular Formula | C30H26N4O2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 6-[(1S)-1-(4-isocyanophenyl)-1-(3-methylimidazol-4-yl)ethyl]-4-(3-methoxyphenyl)-1-methylquinolin-2-one |
| SMILES | [C-]#[N+]c1ccc([C@@](C)(c2ccc3c(c2)c(-c2cccc(OC)c2)cc(=O)n3C)c2cncn2C)cc1 |
| InChI | InChI=1S/C30H26N4O2/c1-30(28-18-32-19-33(28)3,21-9-12-23(31-2)13-10-21)22-11-14-27-26(16-22)25(17-29(35)34(27)4)20-7-6-8-24(15-20)36-5/h6-19H,1,3-5H3/t30-/m0/s1 |
| InChIKey | CSVOCMZFAIHERX-PMERELPUSA-N |
| XLogP | 5.85 |
| TPSA | 53.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|