C23H23F6N3O3 — CID 88859093
2,2,2-trifluoro-1-[1'-[4-methoxy-3-(trifluoromethyl)benzoyl]-4-methylspiro[3,4-dihydro-2H-pyrrolo[1,2-a]pyrazine-1,4'-piperidine]-6-yl]ethanone (PubChem CID 88859093) has the molecular formula C23H23F6N3O3 and a molecular weight of 503.44 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1'-[4-methoxy-3-(trifluoromethyl)benzoyl]-4-methylspiro[3,4-dihydro-2H-pyrrolo[1,2-a]pyrazine-1,4'-piperidine]-6-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[1'-[4-methoxy-3-(trifluoromethyl)benzoyl]-4-methylspiro[3,4-dihydro-2H-pyrrolo[1,2-a]pyrazine-1,4'-piperidine]-6-yl]ethanone |
|---|---|
| PubChem CID | 88859093 |
| Molecular Formula | C23H23F6N3O3 |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 2,2,2-trifluoro-1-[1'-[4-methoxy-3-(trifluoromethyl)benzoyl]-4-methylspiro[3,4-dihydro-2H-pyrrolo[1,2-a]pyrazine-1,4'-piperidine]-6-yl]ethanone |
| SMILES | COc1ccc(C(=O)N2CCC3(CC2)NCC(C)n2c(C(=O)C(F)(F)F)ccc23)cc1C(F)(F)F |
| InChI | InChI=1S/C23H23F6N3O3/c1-13-12-30-21(18-6-4-16(32(13)18)19(33)23(27,28)29)7-9-31(10-8-21)20(34)14-3-5-17(35-2)15(11-14)22(24,25)26/h3-6,11,13,30H,7-10,12H2,1-2H3 |
| InChIKey | BCXADOVOYDQBEZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |