C32H37FN6O6 — CID 88863952
[(4R,6S,7Z,14S,18R)-4-(cyanocarbamoyl)-14-(cyclopropanecarbonylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate (PubChem CID 88863952) has the molecular formula C32H37FN6O6 and a molecular weight of 620.68 g/mol. Its IUPAC name is [(4R,6S,7Z,14S,18R)-4-(cyanocarbamoyl)-14-(cyclopropanecarbonylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | [(4R,6S,7Z,14S,18R)-4-(cyanocarbamoyl)-14-(cyclopropanecarbonylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 88863952 |
| Molecular Formula | C32H37FN6O6 |
| Molecular Weight | 620.68 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | [(4R,6S,7Z,14S,18R)-4-(cyanocarbamoyl)-14-(cyclopropanecarbonylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
| SMILES | N#CNC(=O)[C@@]12C[C@H]1/C=C\CCCCC[C@H](NC(=O)C1CC1)C(=O)N1C[C@H](OC(=O)N3Cc4cccc(F)c4C3)CC1C(=O)N2 |
| InChI | InChI=1S/C32H37FN6O6/c33-24-9-6-7-20-15-38(17-23(20)24)31(44)45-22-13-26-28(41)37-32(30(43)35-18-34)14-21(32)8-4-2-1-3-5-10-25(29(42)39(26)16-22)36-27(40)19-11-12-19/h4,6-9,19,21-22,25-26H,1-3,5,10-17H2,(H,35,43)(H,36,40)(H,37,41)/b8-4-/t21-,22-,25+,26?,32-/m1/s1 |
| InChIKey | AARHFOQNJRTHBS-DWYAJNERSA-N |
| XLogP | 2.13 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.68 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|