C33H41FN6O6 — CID 91461470
[(4R,6S,14S,18R)-4-(cyanocarbamoyl)-14-(2,2-dimethylpropanoylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate (PubChem CID 91461470) has the molecular formula C33H41FN6O6 and a molecular weight of 636.73 g/mol. Its IUPAC name is [(4R,6S,14S,18R)-4-(cyanocarbamoyl)-14-(2,2-dimethylpropanoylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | [(4R,6S,14S,18R)-4-(cyanocarbamoyl)-14-(2,2-dimethylpropanoylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 91461470 |
| Molecular Formula | C33H41FN6O6 |
| Molecular Weight | 636.73 g/mol |
| Exact Mass | 636.31 |
| IUPAC Name | [(4R,6S,14S,18R)-4-(cyanocarbamoyl)-14-(2,2-dimethylpropanoylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
| SMILES | CC(C)(C)C(=O)N[C@H]1CCCCCC=C[C@@H]2C[C@@]2(C(=O)NC#N)NC(=O)C2C[C@@H](OC(=O)N3Cc4cccc(F)c4C3)CN2C1=O |
| InChI | InChI=1S/C33H41FN6O6/c1-32(2,3)29(43)37-25-13-8-6-4-5-7-11-21-15-33(21,30(44)36-19-35)38-27(41)26-14-22(17-40(26)28(25)42)46-31(45)39-16-20-10-9-12-24(34)23(20)18-39/h7,9-12,21-22,25-26H,4-6,8,13-18H2,1-3H3,(H,36,44)(H,37,43)(H,38,41)/t21-,22-,25+,26?,33-/m1/s1 |
| InChIKey | NPUWYHRLALLNKP-FCELNPAISA-N |
| XLogP | 2.77 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|