C19H15N7O — CID 8886551
7-methyl-N-(4-phenyldiazenylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 8886551) has the molecular formula C19H15N7O and a molecular weight of 357.38 g/mol. Its IUPAC name is 7-methyl-N-(4-phenyldiazenylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 7-methyl-N-(4-phenyldiazenylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 8886551 |
| Molecular Formula | C19H15N7O |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 7-methyl-N-(4-phenyldiazenylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1ccnc2nc(C(=O)Nc3ccc(/N=N/c4ccccc4)cc3)nn12 |
| InChI | InChI=1S/C19H15N7O/c1-13-11-12-20-19-22-17(25-26(13)19)18(27)21-14-7-9-16(10-8-14)24-23-15-5-3-2-4-6-15/h2-12H,1H3,(H,21,27)/b24-23+ |
| InChIKey | DMWYWEOIDLYDPE-WCWDXBQESA-N |
| XLogP | 4.10 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|