C47H30BrN3 — CID 88866071
2-(3-bromo-5-phenanthren-9-ylphenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine (PubChem CID 88866071) has the molecular formula C47H30BrN3 and a molecular weight of 716.68 g/mol. Its IUPAC name is 2-(3-bromo-5-phenanthren-9-ylphenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(3-bromo-5-phenanthren-9-ylphenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 88866071 |
| Molecular Formula | C47H30BrN3 |
| Molecular Weight | 716.68 g/mol |
| Exact Mass | 715.16 |
| IUPAC Name | 2-(3-bromo-5-phenanthren-9-ylphenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
| SMILES | Brc1cc(-c2nc(-c3cccc(-c4ccccc4)c3)nc(-c3cccc(-c4ccccc4)c3)n2)cc(-c2cc3ccccc3c3ccccc23)c1 |
| InChI | InChI=1S/C47H30BrN3/c48-40-28-38(44-30-35-17-7-8-22-41(35)42-23-9-10-24-43(42)44)27-39(29-40)47-50-45(36-20-11-18-33(25-36)31-13-3-1-4-14-31)49-46(51-47)37-21-12-19-34(26-37)32-15-5-2-6-16-32/h1-30H |
| InChIKey | JSKMRIKGHSWZTN-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.68 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|