C26H29BN4O5 — CID 88867550
CID 88867550 (PubChem CID 88867550) has the molecular formula C26H29BN4O5 and a molecular weight of 488.35 g/mol.
| Compound Name | CID 88867550 |
|---|---|
| PubChem CID | 88867550 |
| Molecular Formula | C26H29BN4O5 |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | — |
| SMILES | [B]N(Cc1cc2c(cn1)OCCO2)C1CCN(CCn2c(=O)cc(C=O)c3ccc(OC)cc32)CC1 |
| InChI | InChI=1S/C26H29BN4O5/c1-34-21-2-3-22-18(17-32)12-26(33)30(23(22)14-21)9-8-29-6-4-20(5-7-29)31(27)16-19-13-24-25(15-28-19)36-11-10-35-24/h2-3,12-15,17,20H,4-11,16H2,1H3 |
| InChIKey | ULYDKCTZTHUEJI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 86.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|