C23H27BN6O4 — CID 88879014
CID 88879014 (PubChem CID 88879014) has the molecular formula C23H27BN6O4 and a molecular weight of 462.32 g/mol.
| Compound Name | CID 88879014 |
|---|---|
| PubChem CID | 88879014 |
| Molecular Formula | C23H27BN6O4 |
| Molecular Weight | 462.32 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | — |
| SMILES | [B]N(Cc1cc2c(cn1)OCCO2)C1CCN(CCn2c(=O)ccc3cnc(OC)nc32)CC1 |
| InChI | InChI=1S/C23H27BN6O4/c1-32-23-26-13-16-2-3-21(31)29(22(16)27-23)9-8-28-6-4-18(5-7-28)30(24)15-17-12-19-20(14-25-17)34-11-10-33-19/h2-3,12-14,18H,4-11,15H2,1H3 |
| InChIKey | WORVVEFZXHYKRB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 94.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|