C9H14F3NO — CID 88870809
(3E,5E)-N-methyl-6-(trifluoromethoxy)hepta-3,5-dien-3-amine (PubChem CID 88870809) has the molecular formula C9H14F3NO and a molecular weight of 209.21 g/mol. Its IUPAC name is (3E,5E)-N-methyl-6-(trifluoromethoxy)hepta-3,5-dien-3-amine.
| Compound Name | (3E,5E)-N-methyl-6-(trifluoromethoxy)hepta-3,5-dien-3-amine |
|---|---|
| PubChem CID | 88870809 |
| Molecular Formula | C9H14F3NO |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (3E,5E)-N-methyl-6-(trifluoromethoxy)hepta-3,5-dien-3-amine |
| SMILES | CC/C(=C\C=C(/C)OC(F)(F)F)NC |
| InChI | InChI=1S/C9H14F3NO/c1-4-8(13-3)6-5-7(2)14-9(10,11)12/h5-6,13H,4H2,1-3H3/b7-5+,8-6+ |
| InChIKey | ZSWSTCZTKQAJJX-KQQUZDAGSA-N |
| XLogP | 2.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|