C20H22F5NO6 — CID 88870844
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(4,4,5,5,5-pentafluoro-3-oxopentanoyl)phenyl]propanoate (PubChem CID 88870844) has the molecular formula C20H22F5NO6 and a molecular weight of 467.39 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(4,4,5,5,5-pentafluoro-3-oxopentanoyl)phenyl]propanoate.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(4,4,5,5,5-pentafluoro-3-oxopentanoyl)phenyl]propanoate |
|---|---|
| PubChem CID | 88870844 |
| Molecular Formula | C20H22F5NO6 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(4,4,5,5,5-pentafluoro-3-oxopentanoyl)phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(C(=O)CC(=O)C(F)(F)C(F)(F)F)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H22F5NO6/c1-18(2,3)32-17(30)26-13(16(29)31-4)9-11-5-7-12(8-6-11)14(27)10-15(28)19(21,22)20(23,24)25/h5-8,13H,9-10H2,1-4H3,(H,26,30) |
| InChIKey | LVVGGOQVIMDKHU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|