C20H27F2NO6 — CID 159095924
methane;methyl 3-[4-(4,4-difluoro-3-oxobutanoyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 159095924) has the molecular formula C20H27F2NO6 and a molecular weight of 415.43 g/mol. Its IUPAC name is methane;methyl 3-[4-(4,4-difluoro-3-oxobutanoyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methane;methyl 3-[4-(4,4-difluoro-3-oxobutanoyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 159095924 |
| Molecular Formula | C20H27F2NO6 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | methane;methyl 3-[4-(4,4-difluoro-3-oxobutanoyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | C.COC(=O)C(Cc1ccc(C(=O)CC(=O)C(F)F)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H23F2NO6.CH4/c1-19(2,3)28-18(26)22-13(17(25)27-4)9-11-5-7-12(8-6-11)14(23)10-15(24)16(20)21;/h5-8,13,16H,9-10H2,1-4H3,(H,22,26);1H4 |
| InChIKey | KCQYGHQUHIUWJG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|