C12H24N2O5S2 — CID 88872116
2-[2-[2-(3-amino-2-methyl-3-oxopropyl)sulfinylethoxy]ethylsulfinyl]butanamide (PubChem CID 88872116) has the molecular formula C12H24N2O5S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-[2-[2-(3-amino-2-methyl-3-oxopropyl)sulfinylethoxy]ethylsulfinyl]butanamide.
| Compound Name | 2-[2-[2-(3-amino-2-methyl-3-oxopropyl)sulfinylethoxy]ethylsulfinyl]butanamide |
|---|---|
| PubChem CID | 88872116 |
| Molecular Formula | C12H24N2O5S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[2-[2-(3-amino-2-methyl-3-oxopropyl)sulfinylethoxy]ethylsulfinyl]butanamide |
| SMILES | CCC(C(N)=O)S(=O)CCOCCS(=O)CC(C)C(N)=O |
| InChI | InChI=1S/C12H24N2O5S2/c1-3-10(12(14)16)21(18)7-5-19-4-6-20(17)8-9(2)11(13)15/h9-10H,3-8H2,1-2H3,(H2,13,15)(H2,14,16) |
| InChIKey | LRLXAJGNXUAUTO-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|