C27H32N6O3S — CID 88872135
N-[(3R,4R)-1-[(1-formylcyclopropyl)methyl]-4-[(5-methyl-1H-indole-2-carbonyl)amino]pyrrolidin-3-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 88872135) has the molecular formula C27H32N6O3S and a molecular weight of 520.66 g/mol. Its IUPAC name is N-[(3R,4R)-1-[(1-formylcyclopropyl)methyl]-4-[(5-methyl-1H-indole-2-carbonyl)amino]pyrrolidin-3-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[(3R,4R)-1-[(1-formylcyclopropyl)methyl]-4-[(5-methyl-1H-indole-2-carbonyl)amino]pyrrolidin-3-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 88872135 |
| Molecular Formula | C27H32N6O3S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | N-[(3R,4R)-1-[(1-formylcyclopropyl)methyl]-4-[(5-methyl-1H-indole-2-carbonyl)amino]pyrrolidin-3-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | Cc1ccc2[nH]c(C(=O)N[C@@H]3CN(CC4(C=O)CC4)C[C@H]3NC(=O)c3nc4c(s3)CN(C)CC4)cc2c1 |
| InChI | InChI=1S/C27H32N6O3S/c1-16-3-4-18-17(9-16)10-20(28-18)24(35)29-21-11-33(14-27(15-34)6-7-27)12-22(21)30-25(36)26-31-19-5-8-32(2)13-23(19)37-26/h3-4,9-10,15,21-22,28H,5-8,11-14H2,1-2H3,(H,29,35)(H,30,36)/t21-,22-/m1/s1 |
| InChIKey | PLAVOLNWLHYAPT-FGZHOGPDSA-N |
| XLogP | 2.11 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|