C28H33F5N2O6 — CID 88872283
tert-butyl 2-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-[(2,3,4,5,6-pentafluorophenoxy)carbonylamino]ethyl]-1,3-oxazinane-3-carboxylate (PubChem CID 88872283) has the molecular formula C28H33F5N2O6 and a molecular weight of 588.57 g/mol. Its IUPAC name is tert-butyl 2-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-[(2,3,4,5,6-pentafluorophenoxy)carbonylamino]ethyl]-1,3-oxazinane-3-carboxylate.
| Compound Name | tert-butyl 2-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-[(2,3,4,5,6-pentafluorophenoxy)carbonylamino]ethyl]-1,3-oxazinane-3-carboxylate |
|---|---|
| PubChem CID | 88872283 |
| Molecular Formula | C28H33F5N2O6 |
| Molecular Weight | 588.57 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | tert-butyl 2-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-[(2,3,4,5,6-pentafluorophenoxy)carbonylamino]ethyl]-1,3-oxazinane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCOC1C(Cc1ccc(OC(C)(C)C)cc1)NC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C28H33F5N2O6/c1-27(2,3)40-16-10-8-15(9-11-16)14-17(24-35(12-7-13-38-24)26(37)41-28(4,5)6)34-25(36)39-23-21(32)19(30)18(29)20(31)22(23)33/h8-11,17,24H,7,12-14H2,1-6H3,(H,34,36) |
| InChIKey | MBQCZWBIYXYYAQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|