C24H25F5N2O5 — CID 88872329
tert-butyl 2-[1-[(2,3,4,5,6-pentafluorophenoxy)carbonylamino]-2-phenylethyl]-1,3-oxazinane-3-carboxylate (PubChem CID 88872329) has the molecular formula C24H25F5N2O5 and a molecular weight of 516.46 g/mol. Its IUPAC name is tert-butyl 2-[1-[(2,3,4,5,6-pentafluorophenoxy)carbonylamino]-2-phenylethyl]-1,3-oxazinane-3-carboxylate.
| Compound Name | tert-butyl 2-[1-[(2,3,4,5,6-pentafluorophenoxy)carbonylamino]-2-phenylethyl]-1,3-oxazinane-3-carboxylate |
|---|---|
| PubChem CID | 88872329 |
| Molecular Formula | C24H25F5N2O5 |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | tert-butyl 2-[1-[(2,3,4,5,6-pentafluorophenoxy)carbonylamino]-2-phenylethyl]-1,3-oxazinane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCOC1C(Cc1ccccc1)NC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H25F5N2O5/c1-24(2,3)36-23(33)31-10-7-11-34-21(31)14(12-13-8-5-4-6-9-13)30-22(32)35-20-18(28)16(26)15(25)17(27)19(20)29/h4-6,8-9,14,21H,7,10-12H2,1-3H3,(H,30,32) |
| InChIKey | IVCRANJQIVPINV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|