C26H25F3N4O5S — CID 88874325
tert-butyl (2S)-2-[6-[7-(trifluoromethylsulfonyloxy)isoquinolin-3-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 88874325) has the molecular formula C26H25F3N4O5S and a molecular weight of 562.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-[6-[7-(trifluoromethylsulfonyloxy)isoquinolin-3-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[6-[7-(trifluoromethylsulfonyloxy)isoquinolin-3-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 88874325 |
| Molecular Formula | C26H25F3N4O5S |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | tert-butyl (2S)-2-[6-[7-(trifluoromethylsulfonyloxy)isoquinolin-3-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1nc2ccc(-c3cc4ccc(OS(=O)(=O)C(F)(F)F)cc4cn3)cc2[nH]1 |
| InChI | InChI=1S/C26H25F3N4O5S/c1-25(2,3)37-24(34)33-10-4-5-22(33)23-31-19-9-7-16(13-21(19)32-23)20-12-15-6-8-18(11-17(15)14-30-20)38-39(35,36)26(27,28)29/h6-9,11-14,22H,4-5,10H2,1-3H3,(H,31,32)/t22-/m0/s1 |
| InChIKey | DHIGMSBEVAUZNM-QFIPXVFZSA-N |
| XLogP | 6.08 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|