C33H34F5N5O5 — CID 88875428
ethyl 2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetate (PubChem CID 88875428) has the molecular formula C33H34F5N5O5 and a molecular weight of 675.66 g/mol. Its IUPAC name is ethyl 2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetate.
| Compound Name | ethyl 2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetate |
|---|---|
| PubChem CID | 88875428 |
| Molecular Formula | C33H34F5N5O5 |
| Molecular Weight | 675.66 g/mol |
| Exact Mass | 675.25 |
| IUPAC Name | ethyl 2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2,3,4,5,6-pentafluorophenoxy)purin-9-yl]acetate |
| SMILES | CCOC(=O)Cn1cnc2c(Oc3c(F)c(F)c(F)c(F)c3F)nc(N(Cc3ccc(C4CCCCC4)cc3)C(=O)OC(C)(C)C)nc21 |
| InChI | InChI=1S/C33H34F5N5O5/c1-5-46-21(44)16-42-17-39-27-29(42)40-31(41-30(27)47-28-25(37)23(35)22(34)24(36)26(28)38)43(32(45)48-33(2,3)4)15-18-11-13-20(14-12-18)19-9-7-6-8-10-19/h11-14,17,19H,5-10,15-16H2,1-4H3 |
| InChIKey | IHCLTOFROFSDBG-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 108.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.66 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|