C11H7BN2O3 — CID 88880986
CID 88880986 (PubChem CID 88880986) has the molecular formula C11H7BN2O3 and a molecular weight of 226.00 g/mol.
| Compound Name | CID 88880986 |
|---|---|
| PubChem CID | 88880986 |
| Molecular Formula | C11H7BN2O3 |
| Molecular Weight | 226.00 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | — |
| SMILES | [B]n1c(C(=O)O)c(C#N)c2ccc(OC)cc21 |
| InChI | InChI=1S/C11H7BN2O3/c1-17-6-2-3-7-8(5-13)10(11(15)16)14(12)9(7)4-6/h2-4H,1H3,(H,15,16) |
| InChIKey | DONORKZCQARGBH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.00 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|