C19H21N3O — CID 143511248
2-[(2E,4E)-5-aminohepta-2,4,6-trien-2-yl]-1-ethyl-6-methoxyindole-3-carbonitrile (PubChem CID 143511248) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-[(2E,4E)-5-aminohepta-2,4,6-trien-2-yl]-1-ethyl-6-methoxyindole-3-carbonitrile.
| Compound Name | 2-[(2E,4E)-5-aminohepta-2,4,6-trien-2-yl]-1-ethyl-6-methoxyindole-3-carbonitrile |
|---|---|
| PubChem CID | 143511248 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2-[(2E,4E)-5-aminohepta-2,4,6-trien-2-yl]-1-ethyl-6-methoxyindole-3-carbonitrile |
| SMILES | C=C/C(N)=C\C=C(/C)c1c(C#N)c2ccc(OC)cc2n1CC |
| InChI | InChI=1S/C19H21N3O/c1-5-14(21)8-7-13(3)19-17(12-20)16-10-9-15(23-4)11-18(16)22(19)6-2/h5,7-11H,1,6,21H2,2-4H3/b13-7+,14-8+ |
| InChIKey | FCKBDZIMLLGDCF-FNCQTZNRSA-N |
| XLogP | 3.97 |
| TPSA | 63.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|