C25H25FN4OS — CID 88883640
3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethyl-N-(1,3-thiazol-2-yl)hex-5-enamide (PubChem CID 88883640) has the molecular formula C25H25FN4OS and a molecular weight of 448.57 g/mol. Its IUPAC name is 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethyl-N-(1,3-thiazol-2-yl)hex-5-enamide.
| Compound Name | 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethyl-N-(1,3-thiazol-2-yl)hex-5-enamide |
|---|---|
| PubChem CID | 88883640 |
| Molecular Formula | C25H25FN4OS |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethyl-N-(1,3-thiazol-2-yl)hex-5-enamide |
| SMILES | C=C(C)CC(c1ccc2c(cnn2-c2ccc(F)cc2)c1)C(C)(C)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C25H25FN4OS/c1-16(2)13-21(25(3,4)23(31)29-24-27-11-12-32-24)17-5-10-22-18(14-17)15-28-30(22)20-8-6-19(26)7-9-20/h5-12,14-15,21H,1,13H2,2-4H3,(H,27,29,31) |
| InChIKey | SYHJBGBEJLBGBQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|