About 3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide
3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 88883656) has the molecular formula C31H23FN4OS
and a molecular weight of 518.62 g/mol. Its IUPAC name is 3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide.
Molecular Properties
| Compound Name | 3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide |
| PubChem CID | 88883656 |
| Molecular Formula | C31H23FN4OS |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(Nc1nccs1)C(c1ccccc1)C(c1ccccc1)c1ccc2c(cnn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C31H23FN4OS/c32-25-12-14-26(15-13-25)36-27-16-11-23(19-24(27)20-34-36)28(21-7-3-1-4-8-21)29(22-9-5-2-6-10-22)30(37)35-31-33-17-18-38-31/h1-20,28-29H,(H,33,35,37) |
| InChIKey | YNAIUUHYWJGAFN-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide?
The IUPAC name of 3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide (CID 88883656) is 3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide.
What is the SMILES notation for 3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide?
The canonical SMILES for 3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide is O=C(Nc1nccs1)C(c1ccccc1)C(c1ccccc1)c1ccc2c(cnn2-c2ccc(F)cc2)c1.
What is the InChIKey of 3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide?
The InChIKey is YNAIUUHYWJGAFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H23FN4OS/c32-25-12-14-26(15-13-25)36-27-16-11-23(19-24(27)20-34-36)28(21-7-3-1-4-8-21)29(22-9-5-2-6-10-22)30(37)35-31-33-17-18-38-31/h1-20,28-29H,(H,33,35,37).
What are the key properties of 3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide?
3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide has a molecular weight of 518.62 g/mol, XLogP of 7.18, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(4-fluorophenyl)indazol-5-yl]-2,3-diphenyl-N-(1,3-thiazol-2-yl)propanamide is sourced from PubChem (CID 88883656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).