C20H23N5O2 — CID 88885125
2-N-(2,4-dimethylphenyl)-6-methyl-4-N-[2-(methylperoxymethyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 88885125) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-N-(2,4-dimethylphenyl)-6-methyl-4-N-[2-(methylperoxymethyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2,4-dimethylphenyl)-6-methyl-4-N-[2-(methylperoxymethyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 88885125 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-N-(2,4-dimethylphenyl)-6-methyl-4-N-[2-(methylperoxymethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COOCc1ccccc1Nc1nc(C)nc(Nc2ccc(C)cc2C)n1 |
| InChI | InChI=1S/C20H23N5O2/c1-13-9-10-17(14(2)11-13)23-19-21-15(3)22-20(25-19)24-18-8-6-5-7-16(18)12-27-26-4/h5-11H,12H2,1-4H3,(H2,21,22,23,24,25) |
| InChIKey | SQDUGHRQNLXVKH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|