C21H24N8 — CID 88885143
2,6-diamino-N'-[(methylideneamino)-[[4-(2-pyridin-2-ylethyl)phenyl]methyl]amino]pyridine-3-carboximidamide (PubChem CID 88885143) has the molecular formula C21H24N8 and a molecular weight of 388.48 g/mol. Its IUPAC name is 2,6-diamino-N'-[(methylideneamino)-[[4-(2-pyridin-2-ylethyl)phenyl]methyl]amino]pyridine-3-carboximidamide.
| Compound Name | 2,6-diamino-N'-[(methylideneamino)-[[4-(2-pyridin-2-ylethyl)phenyl]methyl]amino]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 88885143 |
| Molecular Formula | C21H24N8 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 2,6-diamino-N'-[(methylideneamino)-[[4-(2-pyridin-2-ylethyl)phenyl]methyl]amino]pyridine-3-carboximidamide |
| SMILES | C=NN(Cc1ccc(CCc2ccccn2)cc1)/N=C(\N)c1ccc(N)nc1N |
| InChI | InChI=1S/C21H24N8/c1-25-29(28-21(24)18-11-12-19(22)27-20(18)23)14-16-7-5-15(6-8-16)9-10-17-4-2-3-13-26-17/h2-8,11-13H,1,9-10,14H2,(H2,24,28)(H4,22,23,27) |
| InChIKey | QROQGLMYIYSJFK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|