C23H18F3N3O4S — CID 88886458
N-(cyanomethyl)-N-[4-(2-methoxyphenyl)-3-pyridinyl]-3-methylsulfonyl-5-(trifluoromethyl)benzamide (PubChem CID 88886458) has the molecular formula C23H18F3N3O4S and a molecular weight of 489.48 g/mol. Its IUPAC name is N-(cyanomethyl)-N-[4-(2-methoxyphenyl)-3-pyridinyl]-3-methylsulfonyl-5-(trifluoromethyl)benzamide.
| Compound Name | N-(cyanomethyl)-N-[4-(2-methoxyphenyl)-3-pyridinyl]-3-methylsulfonyl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 88886458 |
| Molecular Formula | C23H18F3N3O4S |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | N-(cyanomethyl)-N-[4-(2-methoxyphenyl)-3-pyridinyl]-3-methylsulfonyl-5-(trifluoromethyl)benzamide |
| SMILES | COc1ccccc1-c1ccncc1N(CC#N)C(=O)c1cc(C(F)(F)F)cc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H18F3N3O4S/c1-33-21-6-4-3-5-19(21)18-7-9-28-14-20(18)29(10-8-27)22(30)15-11-16(23(24,25)26)13-17(12-15)34(2,31)32/h3-7,9,11-14H,10H2,1-2H3 |
| InChIKey | XWFLSGRKCALBEV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 100.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|