C24H21F3N2O4S — CID 123421680
N-[4-(2-cyclobutyloxyphenyl)-3-pyridinyl]-3-methylsulfonyl-5-(trifluoromethyl)benzamide (PubChem CID 123421680) has the molecular formula C24H21F3N2O4S and a molecular weight of 490.50 g/mol. Its IUPAC name is N-[4-(2-cyclobutyloxyphenyl)-3-pyridinyl]-3-methylsulfonyl-5-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(2-cyclobutyloxyphenyl)-3-pyridinyl]-3-methylsulfonyl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 123421680 |
| Molecular Formula | C24H21F3N2O4S |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | N-[4-(2-cyclobutyloxyphenyl)-3-pyridinyl]-3-methylsulfonyl-5-(trifluoromethyl)benzamide |
| SMILES | CS(=O)(=O)c1cc(C(=O)Nc2cnccc2-c2ccccc2OC2CCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H21F3N2O4S/c1-34(31,32)18-12-15(11-16(13-18)24(25,26)27)23(30)29-21-14-28-10-9-19(21)20-7-2-3-8-22(20)33-17-5-4-6-17/h2-3,7-14,17H,4-6H2,1H3,(H,29,30) |
| InChIKey | BCMWZKJPAIYBHR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |