C5H6O3S — CID 88889846
4-ethynyl-5-methyl-1,3,2-dioxathiolane 2-oxide (PubChem CID 88889846) has the molecular formula C5H6O3S and a molecular weight of 146.17 g/mol. Its IUPAC name is 4-ethynyl-5-methyl-1,3,2-dioxathiolane 2-oxide.
| Compound Name | 4-ethynyl-5-methyl-1,3,2-dioxathiolane 2-oxide |
|---|---|
| PubChem CID | 88889846 |
| Molecular Formula | C5H6O3S |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | 4-ethynyl-5-methyl-1,3,2-dioxathiolane 2-oxide |
| SMILES | C#CC1OS(=O)OC1C |
| InChI | InChI=1S/C5H6O3S/c1-3-5-4(2)7-9(6)8-5/h1,4-5H,2H3 |
| InChIKey | CGZKVQQSWNBHBW-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|