C4H4O2S2 — CID 89445720
4-ethynyl-2-sulfanylidene-1,3,2-dioxathiolane (PubChem CID 89445720) has the molecular formula C4H4O2S2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 4-ethynyl-2-sulfanylidene-1,3,2-dioxathiolane.
| Compound Name | 4-ethynyl-2-sulfanylidene-1,3,2-dioxathiolane |
|---|---|
| PubChem CID | 89445720 |
| Molecular Formula | C4H4O2S2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 147.97 |
| IUPAC Name | 4-ethynyl-2-sulfanylidene-1,3,2-dioxathiolane |
| SMILES | C#CC1COS(=S)O1 |
| InChI | InChI=1S/C4H4O2S2/c1-2-4-3-5-8(7)6-4/h1,4H,3H2 |
| InChIKey | CSYHGQIBXHZZBH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|