C6H4O2S2 — CID 89446404
4,5-diethynyl-2-sulfanylidene-1,3,2-dioxathiolane (PubChem CID 89446404) has the molecular formula C6H4O2S2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 4,5-diethynyl-2-sulfanylidene-1,3,2-dioxathiolane.
| Compound Name | 4,5-diethynyl-2-sulfanylidene-1,3,2-dioxathiolane |
|---|---|
| PubChem CID | 89446404 |
| Molecular Formula | C6H4O2S2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 171.97 |
| IUPAC Name | 4,5-diethynyl-2-sulfanylidene-1,3,2-dioxathiolane |
| SMILES | C#CC1OS(=S)OC1C#C |
| InChI | InChI=1S/C6H4O2S2/c1-3-5-6(4-2)8-10(9)7-5/h1-2,5-6H |
| InChIKey | YXQJMCBSRRAIDY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|