C31H16F6N2 — CID 88890948
2-(9,9'-spirobi[fluorene]-2-yl)-4,6-bis(trifluoromethyl)pyrimidine (PubChem CID 88890948) has the molecular formula C31H16F6N2 and a molecular weight of 530.47 g/mol. Its IUPAC name is 2-(9,9'-spirobi[fluorene]-2-yl)-4,6-bis(trifluoromethyl)pyrimidine.
| Compound Name | 2-(9,9'-spirobi[fluorene]-2-yl)-4,6-bis(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 88890948 |
| Molecular Formula | C31H16F6N2 |
| Molecular Weight | 530.47 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 2-(9,9'-spirobi[fluorene]-2-yl)-4,6-bis(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)nc(-c2ccc3c(c2)C2(c4ccccc4-c4ccccc42)c2ccccc2-3)n1 |
| InChI | InChI=1S/C31H16F6N2/c32-30(33,34)26-16-27(31(35,36)37)39-28(38-26)17-13-14-21-20-9-3-6-12-24(20)29(25(21)15-17)22-10-4-1-7-18(22)19-8-2-5-11-23(19)29/h1-16H |
| InChIKey | XNXPFHHVFBVURE-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.47 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |