C18H17N5O3 — CID 88891224
4-amino-2-benzyl-7-(methylperoxymethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-1-one (PubChem CID 88891224) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is 4-amino-2-benzyl-7-(methylperoxymethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-1-one.
| Compound Name | 4-amino-2-benzyl-7-(methylperoxymethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-1-one |
|---|---|
| PubChem CID | 88891224 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 4-amino-2-benzyl-7-(methylperoxymethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-1-one |
| SMILES | COOCc1ccc2c(c1)nc(N)c1nn(Cc3ccccc3)c(=O)n12 |
| InChI | InChI=1S/C18H17N5O3/c1-25-26-11-13-7-8-15-14(9-13)20-16(19)17-21-22(18(24)23(15)17)10-12-5-3-2-4-6-12/h2-9H,10-11H2,1H3,(H2,19,20) |
| InChIKey | OEULGVSEPLKUOU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|