C27H14Cl2F6N2O5 — CID 88891462
2-[[2,6-bis[3-(trifluoromethyl)phenoxy]-3-pyridinyl]carbamoyl]-4,5-dichlorobenzoic acid (PubChem CID 88891462) has the molecular formula C27H14Cl2F6N2O5 and a molecular weight of 631.31 g/mol. Its IUPAC name is 2-[[2,6-bis[3-(trifluoromethyl)phenoxy]-3-pyridinyl]carbamoyl]-4,5-dichlorobenzoic acid.
| Compound Name | 2-[[2,6-bis[3-(trifluoromethyl)phenoxy]-3-pyridinyl]carbamoyl]-4,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 88891462 |
| Molecular Formula | C27H14Cl2F6N2O5 |
| Molecular Weight | 631.31 g/mol |
| Exact Mass | 630.02 |
| IUPAC Name | 2-[[2,6-bis[3-(trifluoromethyl)phenoxy]-3-pyridinyl]carbamoyl]-4,5-dichlorobenzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(Cl)cc1C(=O)Nc1ccc(Oc2cccc(C(F)(F)F)c2)nc1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H14Cl2F6N2O5/c28-19-11-17(18(25(39)40)12-20(19)29)23(38)36-21-7-8-22(41-15-5-1-3-13(9-15)26(30,31)32)37-24(21)42-16-6-2-4-14(10-16)27(33,34)35/h1-12H,(H,36,38)(H,39,40) |
| InChIKey | YOJIALVYETZGGL-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.31 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |