C19H11N3O2 — CID 88891773
6-pyren-1-yl-1H-1,3,5-triazine-2,4-dione (PubChem CID 88891773) has the molecular formula C19H11N3O2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 6-pyren-1-yl-1H-1,3,5-triazine-2,4-dione.
| Compound Name | 6-pyren-1-yl-1H-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 88891773 |
| Molecular Formula | C19H11N3O2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 6-pyren-1-yl-1H-1,3,5-triazine-2,4-dione |
| SMILES | O=c1nc(-c2ccc3ccc4cccc5ccc2c3c45)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C19H11N3O2/c23-18-20-17(21-19(24)22-18)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H,(H2,20,21,22,23,24) |
| InChIKey | KWHRQZIWPXBJFA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|