C8H12FN3O3S — CID 88894414
4-amino-5-fluoro-1-[(1R)-1-(2-hydroxy-1-sulfanylethoxy)ethyl]pyrimidin-2-one (PubChem CID 88894414) has the molecular formula C8H12FN3O3S and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-amino-5-fluoro-1-[(1R)-1-(2-hydroxy-1-sulfanylethoxy)ethyl]pyrimidin-2-one.
| Compound Name | 4-amino-5-fluoro-1-[(1R)-1-(2-hydroxy-1-sulfanylethoxy)ethyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 88894414 |
| Molecular Formula | C8H12FN3O3S |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 4-amino-5-fluoro-1-[(1R)-1-(2-hydroxy-1-sulfanylethoxy)ethyl]pyrimidin-2-one |
| SMILES | C[C@@H](OC(S)CO)n1cc(F)c(N)nc1=O |
| InChI | InChI=1S/C8H12FN3O3S/c1-4(15-6(16)3-13)12-2-5(9)7(10)11-8(12)14/h2,4,6,13,16H,3H2,1H3,(H2,10,11,14)/t4-,6?/m1/s1 |
| InChIKey | BRXKDRJKBUEZSF-NJXYFUOMSA-N |
| XLogP | -0.25 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|