C38H22F6N8 — CID 88894959
2,9-bis(4-methylphenyl)-12,13-bis[4-(trifluoromethyl)phenyl]-2,4,7,9,11,14-hexazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-5,6-dicarbonitrile (PubChem CID 88894959) has the molecular formula C38H22F6N8 and a molecular weight of 704.64 g/mol. Its IUPAC name is 2,9-bis(4-methylphenyl)-12,13-bis[4-(trifluoromethyl)phenyl]-2,4,7,9,11,14-hexazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-5,6-dicarbonitrile.
| Compound Name | 2,9-bis(4-methylphenyl)-12,13-bis[4-(trifluoromethyl)phenyl]-2,4,7,9,11,14-hexazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 88894959 |
| Molecular Formula | C38H22F6N8 |
| Molecular Weight | 704.64 g/mol |
| Exact Mass | 704.19 |
| IUPAC Name | 2,9-bis(4-methylphenyl)-12,13-bis[4-(trifluoromethyl)phenyl]-2,4,7,9,11,14-hexazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-5,6-dicarbonitrile |
| SMILES | Cc1ccc(N2c3nc(C#N)c(C#N)nc3N(c3ccc(C)cc3)c3nc(-c4ccc(C(F)(F)F)cc4)c(-c4ccc(C(F)(F)F)cc4)nc32)cc1 |
| InChI | InChI=1S/C38H22F6N8/c1-21-3-15-27(16-4-21)51-33-34(48-30(20-46)29(19-45)47-33)52(28-17-5-22(2)6-18-28)36-35(51)49-31(23-7-11-25(12-8-23)37(39,40)41)32(50-36)24-9-13-26(14-10-24)38(42,43)44/h3-18H,1-2H3 |
| InChIKey | BYFXYTCXEFJRAM-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 105.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.64 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |