C28H29NO3 — CID 88896135
5-(4-ethylphenoxy)-2-formyl-N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]benzamide (PubChem CID 88896135) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is 5-(4-ethylphenoxy)-2-formyl-N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]benzamide.
| Compound Name | 5-(4-ethylphenoxy)-2-formyl-N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 88896135 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 5-(4-ethylphenoxy)-2-formyl-N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]benzamide |
| SMILES | C=C(C)c1cccc(C(C)(C)NC(=O)c2cc(Oc3ccc(CC)cc3)ccc2C=O)c1 |
| InChI | InChI=1S/C28H29NO3/c1-6-20-10-13-24(14-11-20)32-25-15-12-22(18-30)26(17-25)27(31)29-28(4,5)23-9-7-8-21(16-23)19(2)3/h7-18H,2,6H2,1,3-5H3,(H,29,31) |
| InChIKey | FUTDICHFINQVRJ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|