C14H12IN5OS — CID 88896395
3-[(5-cyano-6-iodo-2-sulfanylidene-1H-pyrimidin-4-yl)amino]-N,4-dimethylbenzamide (PubChem CID 88896395) has the molecular formula C14H12IN5OS and a molecular weight of 425.26 g/mol. Its IUPAC name is 3-[(5-cyano-6-iodo-2-sulfanylidene-1H-pyrimidin-4-yl)amino]-N,4-dimethylbenzamide.
| Compound Name | 3-[(5-cyano-6-iodo-2-sulfanylidene-1H-pyrimidin-4-yl)amino]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 88896395 |
| Molecular Formula | C14H12IN5OS |
| Molecular Weight | 425.26 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | 3-[(5-cyano-6-iodo-2-sulfanylidene-1H-pyrimidin-4-yl)amino]-N,4-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(C)c(Nc2nc(=S)[nH]c(I)c2C#N)c1 |
| InChI | InChI=1S/C14H12IN5OS/c1-7-3-4-8(13(21)17-2)5-10(7)18-12-9(6-16)11(15)19-14(22)20-12/h3-5H,1-2H3,(H,17,21)(H2,18,19,20,22) |
| InChIKey | TYIGDDLCJTVEMY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|