C17H20ClN5O2S — CID 142201961
3-[(6-chloro-5-cyano-2-methylsulfanylpyrimidin-4-yl)amino]-N-methoxy-4-methylbenzamide;ethane (PubChem CID 142201961) has the molecular formula C17H20ClN5O2S and a molecular weight of 393.90 g/mol. Its IUPAC name is 3-[(6-chloro-5-cyano-2-methylsulfanylpyrimidin-4-yl)amino]-N-methoxy-4-methylbenzamide;ethane.
| Compound Name | 3-[(6-chloro-5-cyano-2-methylsulfanylpyrimidin-4-yl)amino]-N-methoxy-4-methylbenzamide;ethane |
|---|---|
| PubChem CID | 142201961 |
| Molecular Formula | C17H20ClN5O2S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 3-[(6-chloro-5-cyano-2-methylsulfanylpyrimidin-4-yl)amino]-N-methoxy-4-methylbenzamide;ethane |
| SMILES | CC.CONC(=O)c1ccc(C)c(Nc2nc(SC)nc(Cl)c2C#N)c1 |
| InChI | InChI=1S/C15H14ClN5O2S.C2H6/c1-8-4-5-9(14(22)21-23-2)6-11(8)18-13-10(7-17)12(16)19-15(20-13)24-3;1-2/h4-6H,1-3H3,(H,21,22)(H,18,19,20);1-2H3 |
| InChIKey | IDWVMFJUMHKSFM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|