C19H26FN5O2 — CID 20800435
3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-fluoropyrimidin-2-yl]amino]-N-methoxy-4-methylbenzamide (PubChem CID 20800435) has the molecular formula C19H26FN5O2 and a molecular weight of 375.45 g/mol. Its IUPAC name is 3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-fluoropyrimidin-2-yl]amino]-N-methoxy-4-methylbenzamide.
| Compound Name | 3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-fluoropyrimidin-2-yl]amino]-N-methoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 20800435 |
| Molecular Formula | C19H26FN5O2 |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-fluoropyrimidin-2-yl]amino]-N-methoxy-4-methylbenzamide |
| SMILES | CONC(=O)c1ccc(C)c(Nc2nc(F)cc(N(C)CC(C)(C)C)n2)c1 |
| InChI | InChI=1S/C19H26FN5O2/c1-12-7-8-13(17(26)24-27-6)9-14(12)21-18-22-15(20)10-16(23-18)25(5)11-19(2,3)4/h7-10H,11H2,1-6H3,(H,24,26)(H,21,22,23) |
| InChIKey | ZFHAWCVIFRZVFY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|