C22H33BN8O — CID 88896400
CID 88896400 (PubChem CID 88896400) has the molecular formula C22H33BN8O and a molecular weight of 436.37 g/mol.
| Compound Name | CID 88896400 |
|---|---|
| PubChem CID | 88896400 |
| Molecular Formula | C22H33BN8O |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | — |
| SMILES | [B]N1CC[C@@H](Nc2nc(Nc3cc(C(=O)NC)ccc3C)nc(N(C)CC(C)(C)C)n2)C1 |
| InChI | InChI=1S/C22H33BN8O/c1-14-7-8-15(18(32)24-5)11-17(14)26-20-27-19(25-16-9-10-31(23)12-16)28-21(29-20)30(6)13-22(2,3)4/h7-8,11,16H,9-10,12-13H2,1-6H3,(H,24,32)(H2,25,26,27,28,29)/t16-/m1/s1 |
| InChIKey | GNKLBCYFHPHOPT-MRXNPFEDSA-N |
| XLogP | 2.34 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|