C23H35N7O4S — CID 10118111
3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-[(1,1-dioxothiolan-3-yl)amino]-1,3,5-triazin-2-yl]amino]-N-ethoxy-4-methylbenzamide (PubChem CID 10118111) has the molecular formula C23H35N7O4S and a molecular weight of 505.65 g/mol. Its IUPAC name is 3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-[(1,1-dioxothiolan-3-yl)amino]-1,3,5-triazin-2-yl]amino]-N-ethoxy-4-methylbenzamide.
| Compound Name | 3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-[(1,1-dioxothiolan-3-yl)amino]-1,3,5-triazin-2-yl]amino]-N-ethoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 10118111 |
| Molecular Formula | C23H35N7O4S |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-[(1,1-dioxothiolan-3-yl)amino]-1,3,5-triazin-2-yl]amino]-N-ethoxy-4-methylbenzamide |
| SMILES | CCONC(=O)c1ccc(C)c(Nc2nc(NC3CCS(=O)(=O)C3)nc(N(C)CC(C)(C)C)n2)c1 |
| InChI | InChI=1S/C23H35N7O4S/c1-7-34-29-19(31)16-9-8-15(2)18(12-16)25-21-26-20(24-17-10-11-35(32,33)13-17)27-22(28-21)30(6)14-23(3,4)5/h8-9,12,17H,7,10-11,13-14H2,1-6H3,(H,29,31)(H2,24,25,26,27,28) |
| InChIKey | OQXKLHPEHGRRHG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|