C11H20N6O2S — CID 80786050
4-N-(1,1-dioxothiolan-3-yl)-6-N-ethyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80786050) has the molecular formula C11H20N6O2S and a molecular weight of 300.39 g/mol. Its IUPAC name is 4-N-(1,1-dioxothiolan-3-yl)-6-N-ethyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(1,1-dioxothiolan-3-yl)-6-N-ethyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80786050 |
| Molecular Formula | C11H20N6O2S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-N-(1,1-dioxothiolan-3-yl)-6-N-ethyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NC2CCS(=O)(=O)C2)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H20N6O2S/c1-4-12-9-14-10(16-11(15-9)17(2)3)13-8-5-6-20(18,19)7-8/h8H,4-7H2,1-3H3,(H2,12,13,14,15,16) |
| InChIKey | NLJLJJGSMMXDAQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |