C23H36N8O2 — CID 11786421
3-[[4-(1,4-diazepan-1-yl)-6-[2,2-dimethylpropyl(methyl)amino]-1,3,5-triazin-2-yl]amino]-N-methoxy-4-methylbenzamide (PubChem CID 11786421) has the molecular formula C23H36N8O2 and a molecular weight of 456.60 g/mol. Its IUPAC name is 3-[[4-(1,4-diazepan-1-yl)-6-[2,2-dimethylpropyl(methyl)amino]-1,3,5-triazin-2-yl]amino]-N-methoxy-4-methylbenzamide.
| Compound Name | 3-[[4-(1,4-diazepan-1-yl)-6-[2,2-dimethylpropyl(methyl)amino]-1,3,5-triazin-2-yl]amino]-N-methoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 11786421 |
| Molecular Formula | C23H36N8O2 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | 3-[[4-(1,4-diazepan-1-yl)-6-[2,2-dimethylpropyl(methyl)amino]-1,3,5-triazin-2-yl]amino]-N-methoxy-4-methylbenzamide |
| SMILES | CONC(=O)c1ccc(C)c(Nc2nc(N(C)CC(C)(C)C)nc(N3CCCNCC3)n2)c1 |
| InChI | InChI=1S/C23H36N8O2/c1-16-8-9-17(19(32)29-33-6)14-18(16)25-20-26-21(30(5)15-23(2,3)4)28-22(27-20)31-12-7-10-24-11-13-31/h8-9,14,24H,7,10-13,15H2,1-6H3,(H,29,32)(H,25,26,27,28) |
| InChIKey | VVRZRWAFPSSXJF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|