C22H34N8O2 — CID 11376336
3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-piperazin-1-yl-1,3,5-triazin-2-yl]amino]-N-methoxy-4-methylbenzamide (PubChem CID 11376336) has the molecular formula C22H34N8O2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-piperazin-1-yl-1,3,5-triazin-2-yl]amino]-N-methoxy-4-methylbenzamide.
| Compound Name | 3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-piperazin-1-yl-1,3,5-triazin-2-yl]amino]-N-methoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 11376336 |
| Molecular Formula | C22H34N8O2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-piperazin-1-yl-1,3,5-triazin-2-yl]amino]-N-methoxy-4-methylbenzamide |
| SMILES | CONC(=O)c1ccc(C)c(Nc2nc(N(C)CC(C)(C)C)nc(N3CCNCC3)n2)c1 |
| InChI | InChI=1S/C22H34N8O2/c1-15-7-8-16(18(31)28-32-6)13-17(15)24-19-25-20(29(5)14-22(2,3)4)27-21(26-19)30-11-9-23-10-12-30/h7-8,13,23H,9-12,14H2,1-6H3,(H,28,31)(H,24,25,26,27) |
| InChIKey | GXGGUWUBVCDZOA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|