C18H24ClN5O2S — CID 20800409
3-[[4-chloro-6-[2,2-dimethylpropyl(methyl)amino]-1,3,5-triazin-2-yl]sulfanyl]-N-methoxy-4-methylbenzamide (PubChem CID 20800409) has the molecular formula C18H24ClN5O2S and a molecular weight of 409.94 g/mol. Its IUPAC name is 3-[[4-chloro-6-[2,2-dimethylpropyl(methyl)amino]-1,3,5-triazin-2-yl]sulfanyl]-N-methoxy-4-methylbenzamide.
| Compound Name | 3-[[4-chloro-6-[2,2-dimethylpropyl(methyl)amino]-1,3,5-triazin-2-yl]sulfanyl]-N-methoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 20800409 |
| Molecular Formula | C18H24ClN5O2S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 3-[[4-chloro-6-[2,2-dimethylpropyl(methyl)amino]-1,3,5-triazin-2-yl]sulfanyl]-N-methoxy-4-methylbenzamide |
| SMILES | CONC(=O)c1ccc(C)c(Sc2nc(Cl)nc(N(C)CC(C)(C)C)n2)c1 |
| InChI | InChI=1S/C18H24ClN5O2S/c1-11-7-8-12(14(25)23-26-6)9-13(11)27-17-21-15(19)20-16(22-17)24(5)10-18(2,3)4/h7-9H,10H2,1-6H3,(H,23,25) |
| InChIKey | YCMODZFYTLGZPE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|