C18H13ClN2O3S — CID 88899352
methyl 4-[(3-carbamothioyl-6-chlorochromen-2-ylidene)amino]benzoate (PubChem CID 88899352) has the molecular formula C18H13ClN2O3S and a molecular weight of 372.83 g/mol. Its IUPAC name is methyl 4-[(3-carbamothioyl-6-chlorochromen-2-ylidene)amino]benzoate.
| Compound Name | methyl 4-[(3-carbamothioyl-6-chlorochromen-2-ylidene)amino]benzoate |
|---|---|
| PubChem CID | 88899352 |
| Molecular Formula | C18H13ClN2O3S |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | methyl 4-[(3-carbamothioyl-6-chlorochromen-2-ylidene)amino]benzoate |
| SMILES | COC(=O)c1ccc(/N=c2\oc3ccc(Cl)cc3cc2C(N)=S)cc1 |
| InChI | InChI=1S/C18H13ClN2O3S/c1-23-18(22)10-2-5-13(6-3-10)21-17-14(16(20)25)9-11-8-12(19)4-7-15(11)24-17/h2-9H,1H3,(H2,20,25)/b21-17- |
| InChIKey | WDEHDTMFTCAGKZ-FXBPSFAMSA-N |
| XLogP | 3.74 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|